About 1-[[5-(3-chlorophenyl)-1,3-oxazol-2-yl]methyl]-3-methylpiperidin-4-amine;dihydrochloride
1-[[5-(3-chlorophenyl)-1,3-oxazol-2-yl]methyl]-3-methylpiperidin-4-amine;dihydrochloride (PubChem CID 119924998) has the molecular formula C16H22Cl3N3O
and a molecular weight of 378.73 g/mol. Its IUPAC name is 1-[[5-(3-chlorophenyl)-1,3-oxazol-2-yl]methyl]-3-methylpiperidin-4-amine;dihydrochloride.
Molecular Properties
| Compound Name | 1-[[5-(3-chlorophenyl)-1,3-oxazol-2-yl]methyl]-3-methylpiperidin-4-amine;dihydrochloride |
| PubChem CID | 119924998 |
| Molecular Formula | C16H22Cl3N3O |
| Molecular Weight | 378.73 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 1-[[5-(3-chlorophenyl)-1,3-oxazol-2-yl]methyl]-3-methylpiperidin-4-amine;dihydrochloride |
| SMILES | CC1CN(Cc2ncc(-c3cccc(Cl)c3)o2)CCC1N.Cl.Cl |
| InChI | InChI=1S/C16H20ClN3O.2ClH/c1-11-9-20(6-5-14(11)18)10-16-19-8-15(21-16)12-3-2-4-13(17)7-12;;/h2-4,7-8,11,14H,5-6,9-10,18H2,1H3;2*1H |
| InChIKey | ZLZWDKROKFFBET-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.73 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[[5-(3-chlorophenyl)-1,3-oxazol-2-yl]methyl]-3-methylpiperidin-4-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[5-(3-chlorophenyl)-1,3-oxazol-2-yl]methyl]-3-methylpiperidin-4-amine;dihydrochloride?
The IUPAC name of 1-[[5-(3-chlorophenyl)-1,3-oxazol-2-yl]methyl]-3-methylpiperidin-4-amine;dihydrochloride (CID 119924998) is 1-[[5-(3-chlorophenyl)-1,3-oxazol-2-yl]methyl]-3-methylpiperidin-4-amine;dihydrochloride.
What is the SMILES notation for 1-[[5-(3-chlorophenyl)-1,3-oxazol-2-yl]methyl]-3-methylpiperidin-4-amine;dihydrochloride?
The canonical SMILES for 1-[[5-(3-chlorophenyl)-1,3-oxazol-2-yl]methyl]-3-methylpiperidin-4-amine;dihydrochloride is CC1CN(Cc2ncc(-c3cccc(Cl)c3)o2)CCC1N.Cl.Cl.
What is the InChIKey of 1-[[5-(3-chlorophenyl)-1,3-oxazol-2-yl]methyl]-3-methylpiperidin-4-amine;dihydrochloride?
The InChIKey is ZLZWDKROKFFBET-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20ClN3O.2ClH/c1-11-9-20(6-5-14(11)18)10-16-19-8-15(21-16)12-3-2-4-13(17)7-12;;/h2-4,7-8,11,14H,5-6,9-10,18H2,1H3;2*1H.
What are the key properties of 1-[[5-(3-chlorophenyl)-1,3-oxazol-2-yl]methyl]-3-methylpiperidin-4-amine;dihydrochloride?
1-[[5-(3-chlorophenyl)-1,3-oxazol-2-yl]methyl]-3-methylpiperidin-4-amine;dihydrochloride has a molecular weight of 378.73 g/mol, XLogP of 4.01, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[5-(3-chlorophenyl)-1,3-oxazol-2-yl]methyl]-3-methylpiperidin-4-amine;dihydrochloride is sourced from PubChem (CID 119924998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).