About [1-[(2,5-dimethylthiophen-3-yl)methyl]-3-methylpiperidin-2-yl]methanamine;hydrochloride
[1-[(2,5-dimethylthiophen-3-yl)methyl]-3-methylpiperidin-2-yl]methanamine;hydrochloride (PubChem CID 119926209) has the molecular formula C14H25ClN2S
and a molecular weight of 288.89 g/mol. Its IUPAC name is [1-[(2,5-dimethylthiophen-3-yl)methyl]-3-methylpiperidin-2-yl]methanamine;hydrochloride.
Molecular Properties
| Compound Name | [1-[(2,5-dimethylthiophen-3-yl)methyl]-3-methylpiperidin-2-yl]methanamine;hydrochloride |
| PubChem CID | 119926209 |
| Molecular Formula | C14H25ClN2S |
| Molecular Weight | 288.89 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | [1-[(2,5-dimethylthiophen-3-yl)methyl]-3-methylpiperidin-2-yl]methanamine;hydrochloride |
| SMILES | Cc1cc(CN2CCCC(C)C2CN)c(C)s1.Cl |
| InChI | InChI=1S/C14H24N2S.ClH/c1-10-5-4-6-16(14(10)8-15)9-13-7-11(2)17-12(13)3;/h7,10,14H,4-6,8-9,15H2,1-3H3;1H |
| InChIKey | SWVUHOQGUMJWRO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.89 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-[(2,5-dimethylthiophen-3-yl)methyl]-3-methylpiperidin-2-yl]methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(2,5-dimethylthiophen-3-yl)methyl]-3-methylpiperidin-2-yl]methanamine;hydrochloride?
The IUPAC name of [1-[(2,5-dimethylthiophen-3-yl)methyl]-3-methylpiperidin-2-yl]methanamine;hydrochloride (CID 119926209) is [1-[(2,5-dimethylthiophen-3-yl)methyl]-3-methylpiperidin-2-yl]methanamine;hydrochloride.
What is the SMILES notation for [1-[(2,5-dimethylthiophen-3-yl)methyl]-3-methylpiperidin-2-yl]methanamine;hydrochloride?
The canonical SMILES for [1-[(2,5-dimethylthiophen-3-yl)methyl]-3-methylpiperidin-2-yl]methanamine;hydrochloride is Cc1cc(CN2CCCC(C)C2CN)c(C)s1.Cl.
What is the InChIKey of [1-[(2,5-dimethylthiophen-3-yl)methyl]-3-methylpiperidin-2-yl]methanamine;hydrochloride?
The InChIKey is SWVUHOQGUMJWRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2S.ClH/c1-10-5-4-6-16(14(10)8-15)9-13-7-11(2)17-12(13)3;/h7,10,14H,4-6,8-9,15H2,1-3H3;1H.
What are the key properties of [1-[(2,5-dimethylthiophen-3-yl)methyl]-3-methylpiperidin-2-yl]methanamine;hydrochloride?
[1-[(2,5-dimethylthiophen-3-yl)methyl]-3-methylpiperidin-2-yl]methanamine;hydrochloride has a molecular weight of 288.89 g/mol, XLogP of 3.35, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(2,5-dimethylthiophen-3-yl)methyl]-3-methylpiperidin-2-yl]methanamine;hydrochloride is sourced from PubChem (CID 119926209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).