C18H28ClN3O — CID 119926842
2-[4-(cyclopropylmethylamino)piperidin-1-yl]-N-phenylpropanamide;hydrochloride (PubChem CID 119926842) has the molecular formula C18H28ClN3O and a molecular weight of 337.89 g/mol. Its IUPAC name is 2-[4-(cyclopropylmethylamino)piperidin-1-yl]-N-phenylpropanamide;hydrochloride.
| Compound Name | 2-[4-(cyclopropylmethylamino)piperidin-1-yl]-N-phenylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 119926842 |
| Molecular Formula | C18H28ClN3O |
| Molecular Weight | 337.89 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 2-[4-(cyclopropylmethylamino)piperidin-1-yl]-N-phenylpropanamide;hydrochloride |
| SMILES | CC(C(=O)Nc1ccccc1)N1CCC(NCC2CC2)CC1.Cl |
| InChI | InChI=1S/C18H27N3O.ClH/c1-14(18(22)20-17-5-3-2-4-6-17)21-11-9-16(10-12-21)19-13-15-7-8-15;/h2-6,14-16,19H,7-13H2,1H3,(H,20,22);1H |
| InChIKey | BKWKTBYHXNSMNV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.89 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |