C13H26ClN3O — CID 119926969
2-[2-(aminomethyl)pyrrolidin-1-yl]-N-cyclohexylacetamide;hydrochloride (PubChem CID 119926969) has the molecular formula C13H26ClN3O and a molecular weight of 275.82 g/mol. Its IUPAC name is 2-[2-(aminomethyl)pyrrolidin-1-yl]-N-cyclohexylacetamide;hydrochloride.
| Compound Name | 2-[2-(aminomethyl)pyrrolidin-1-yl]-N-cyclohexylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119926969 |
| Molecular Formula | C13H26ClN3O |
| Molecular Weight | 275.82 g/mol |
| Exact Mass | 275.18 |
| IUPAC Name | 2-[2-(aminomethyl)pyrrolidin-1-yl]-N-cyclohexylacetamide;hydrochloride |
| SMILES | Cl.NCC1CCCN1CC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C13H25N3O.ClH/c14-9-12-7-4-8-16(12)10-13(17)15-11-5-2-1-3-6-11;/h11-12H,1-10,14H2,(H,15,17);1H |
| InChIKey | HEIOKVCHIHLNKN-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.82 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |