C15H22ClN3O — CID 119927575
3-(3,9-diazabicyclo[4.2.1]nonan-3-ylmethyl)benzamide;hydrochloride (PubChem CID 119927575) has the molecular formula C15H22ClN3O and a molecular weight of 295.81 g/mol. Its IUPAC name is 3-(3,9-diazabicyclo[4.2.1]nonan-3-ylmethyl)benzamide;hydrochloride.
| Compound Name | 3-(3,9-diazabicyclo[4.2.1]nonan-3-ylmethyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119927575 |
| Molecular Formula | C15H22ClN3O |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 3-(3,9-diazabicyclo[4.2.1]nonan-3-ylmethyl)benzamide;hydrochloride |
| SMILES | Cl.NC(=O)c1cccc(CN2CCC3CCC(C2)N3)c1 |
| InChI | InChI=1S/C15H21N3O.ClH/c16-15(19)12-3-1-2-11(8-12)9-18-7-6-13-4-5-14(10-18)17-13;/h1-3,8,13-14,17H,4-7,9-10H2,(H2,16,19);1H |
| InChIKey | YLBPKQAHLQEDTF-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |