C28H38O2 — CID 11992774
4-[2-methyl-5-[phenyl-(3,3,5,5-tetramethylcyclohexylidene)methyl]phenoxy]butan-1-ol (PubChem CID 11992774) has the molecular formula C28H38O2 and a molecular weight of 406.61 g/mol. Its IUPAC name is 4-[2-methyl-5-[phenyl-(3,3,5,5-tetramethylcyclohexylidene)methyl]phenoxy]butan-1-ol.
| Compound Name | 4-[2-methyl-5-[phenyl-(3,3,5,5-tetramethylcyclohexylidene)methyl]phenoxy]butan-1-ol |
|---|---|
| PubChem CID | 11992774 |
| Molecular Formula | C28H38O2 |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.29 |
| IUPAC Name | 4-[2-methyl-5-[phenyl-(3,3,5,5-tetramethylcyclohexylidene)methyl]phenoxy]butan-1-ol |
| SMILES | Cc1ccc(C(=C2CC(C)(C)CC(C)(C)C2)c2ccccc2)cc1OCCCCO |
| InChI | InChI=1S/C28H38O2/c1-21-13-14-23(17-25(21)30-16-10-9-15-29)26(22-11-7-6-8-12-22)24-18-27(2,3)20-28(4,5)19-24/h6-8,11-14,17,29H,9-10,15-16,18-20H2,1-5H3 |
| InChIKey | MOZSJLQQCGBWIH-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|