C28H38O3 — CID 11992776
2-[2-[2-methyl-5-[phenyl-(3,3,5,5-tetramethylcyclohexylidene)methyl]phenoxy]ethoxy]ethanol (PubChem CID 11992776) has the molecular formula C28H38O3 and a molecular weight of 422.61 g/mol. Its IUPAC name is 2-[2-[2-methyl-5-[phenyl-(3,3,5,5-tetramethylcyclohexylidene)methyl]phenoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[2-methyl-5-[phenyl-(3,3,5,5-tetramethylcyclohexylidene)methyl]phenoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 11992776 |
| Molecular Formula | C28H38O3 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.28 |
| IUPAC Name | 2-[2-[2-methyl-5-[phenyl-(3,3,5,5-tetramethylcyclohexylidene)methyl]phenoxy]ethoxy]ethanol |
| SMILES | Cc1ccc(C(=C2CC(C)(C)CC(C)(C)C2)c2ccccc2)cc1OCCOCCO |
| InChI | InChI=1S/C28H38O3/c1-21-11-12-23(17-25(21)31-16-15-30-14-13-29)26(22-9-7-6-8-10-22)24-18-27(2,3)20-28(4,5)19-24/h6-12,17,29H,13-16,18-20H2,1-5H3 |
| InChIKey | XLUOTQUNKSSYOJ-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|