C15H25BrCl2N4O — CID 119928120
N-(5-bromo-2-pyridinyl)-2-[4-(ethylaminomethyl)piperidin-1-yl]acetamide;dihydrochloride (PubChem CID 119928120) has the molecular formula C15H25BrCl2N4O and a molecular weight of 428.20 g/mol. Its IUPAC name is N-(5-bromo-2-pyridinyl)-2-[4-(ethylaminomethyl)piperidin-1-yl]acetamide;dihydrochloride.
| Compound Name | N-(5-bromo-2-pyridinyl)-2-[4-(ethylaminomethyl)piperidin-1-yl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119928120 |
| Molecular Formula | C15H25BrCl2N4O |
| Molecular Weight | 428.20 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | N-(5-bromo-2-pyridinyl)-2-[4-(ethylaminomethyl)piperidin-1-yl]acetamide;dihydrochloride |
| SMILES | CCNCC1CCN(CC(=O)Nc2ccc(Br)cn2)CC1.Cl.Cl |
| InChI | InChI=1S/C15H23BrN4O.2ClH/c1-2-17-9-12-5-7-20(8-6-12)11-15(21)19-14-4-3-13(16)10-18-14;;/h3-4,10,12,17H,2,5-9,11H2,1H3,(H,18,19,21);2*1H |
| InChIKey | XMESORNDSHHTFG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.20 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |