C14H21ClFN3O — CID 119928586
N-(3-fluorophenyl)-2-[2-(methylaminomethyl)pyrrolidin-1-yl]acetamide;hydrochloride (PubChem CID 119928586) has the molecular formula C14H21ClFN3O and a molecular weight of 301.79 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-[2-(methylaminomethyl)pyrrolidin-1-yl]acetamide;hydrochloride.
| Compound Name | N-(3-fluorophenyl)-2-[2-(methylaminomethyl)pyrrolidin-1-yl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119928586 |
| Molecular Formula | C14H21ClFN3O |
| Molecular Weight | 301.79 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | N-(3-fluorophenyl)-2-[2-(methylaminomethyl)pyrrolidin-1-yl]acetamide;hydrochloride |
| SMILES | CNCC1CCCN1CC(=O)Nc1cccc(F)c1.Cl |
| InChI | InChI=1S/C14H20FN3O.ClH/c1-16-9-13-6-3-7-18(13)10-14(19)17-12-5-2-4-11(15)8-12;/h2,4-5,8,13,16H,3,6-7,9-10H2,1H3,(H,17,19);1H |
| InChIKey | MGRYPKRWVCPDOF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.79 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |