C20H17NO3S — CID 11992885
3-[(benzylamino)methyl]-2,3-dihydrobenzo[f][1,4]benzoxathiine-5,6-dione (PubChem CID 11992885) has the molecular formula C20H17NO3S and a molecular weight of 351.43 g/mol. Its IUPAC name is 3-[(benzylamino)methyl]-2,3-dihydrobenzo[f][1,4]benzoxathiine-5,6-dione.
| Compound Name | 3-[(benzylamino)methyl]-2,3-dihydrobenzo[f][1,4]benzoxathiine-5,6-dione |
|---|---|
| PubChem CID | 11992885 |
| Molecular Formula | C20H17NO3S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 3-[(benzylamino)methyl]-2,3-dihydrobenzo[f][1,4]benzoxathiine-5,6-dione |
| SMILES | O=C1C(=O)c2ccccc2C2=C1OC(CNCc1ccccc1)CS2 |
| InChI | InChI=1S/C20H17NO3S/c22-17-15-8-4-5-9-16(15)20-19(18(17)23)24-14(12-25-20)11-21-10-13-6-2-1-3-7-13/h1-9,14,21H,10-12H2 |
| InChIKey | DOVWESMPLXZISB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|