About tert-butyl 4-(5-tert-butyl-1,2,4-oxadiazol-3-yl)piperazine-1-carboxylate
tert-butyl 4-(5-tert-butyl-1,2,4-oxadiazol-3-yl)piperazine-1-carboxylate (PubChem CID 11992899) has the molecular formula C15H26N4O3
and a molecular weight of 310.40 g/mol. Its IUPAC name is tert-butyl 4-(5-tert-butyl-1,2,4-oxadiazol-3-yl)piperazine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-(5-tert-butyl-1,2,4-oxadiazol-3-yl)piperazine-1-carboxylate |
| PubChem CID | 11992899 |
| Molecular Formula | C15H26N4O3 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | tert-butyl 4-(5-tert-butyl-1,2,4-oxadiazol-3-yl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2noc(C(C)(C)C)n2)CC1 |
| InChI | InChI=1S/C15H26N4O3/c1-14(2,3)11-16-12(17-22-11)18-7-9-19(10-8-18)13(20)21-15(4,5)6/h7-10H2,1-6H3 |
| InChIKey | GBOFLIREOMGORL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 71.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl 4-(5-tert-butyl-1,2,4-oxadiazol-3-yl)piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-(5-tert-butyl-1,2,4-oxadiazol-3-yl)piperazine-1-carboxylate?
The IUPAC name of tert-butyl 4-(5-tert-butyl-1,2,4-oxadiazol-3-yl)piperazine-1-carboxylate (CID 11992899) is tert-butyl 4-(5-tert-butyl-1,2,4-oxadiazol-3-yl)piperazine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-(5-tert-butyl-1,2,4-oxadiazol-3-yl)piperazine-1-carboxylate?
The canonical SMILES for tert-butyl 4-(5-tert-butyl-1,2,4-oxadiazol-3-yl)piperazine-1-carboxylate is CC(C)(C)OC(=O)N1CCN(c2noc(C(C)(C)C)n2)CC1.
What is the InChIKey of tert-butyl 4-(5-tert-butyl-1,2,4-oxadiazol-3-yl)piperazine-1-carboxylate?
The InChIKey is GBOFLIREOMGORL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N4O3/c1-14(2,3)11-16-12(17-22-11)18-7-9-19(10-8-18)13(20)21-15(4,5)6/h7-10H2,1-6H3.
What are the key properties of tert-butyl 4-(5-tert-butyl-1,2,4-oxadiazol-3-yl)piperazine-1-carboxylate?
tert-butyl 4-(5-tert-butyl-1,2,4-oxadiazol-3-yl)piperazine-1-carboxylate has a molecular weight of 310.40 g/mol, XLogP of 2.42, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-(5-tert-butyl-1,2,4-oxadiazol-3-yl)piperazine-1-carboxylate is sourced from PubChem (CID 11992899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).