C14H22ClFN2 — CID 119929453
N-[(3-fluorophenyl)methyl]-N-methyl-1-piperidin-3-ylmethanamine;hydrochloride (PubChem CID 119929453) has the molecular formula C14H22ClFN2 and a molecular weight of 272.79 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-N-methyl-1-piperidin-3-ylmethanamine;hydrochloride.
| Compound Name | N-[(3-fluorophenyl)methyl]-N-methyl-1-piperidin-3-ylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 119929453 |
| Molecular Formula | C14H22ClFN2 |
| Molecular Weight | 272.79 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-N-methyl-1-piperidin-3-ylmethanamine;hydrochloride |
| SMILES | CN(Cc1cccc(F)c1)CC1CCCNC1.Cl |
| InChI | InChI=1S/C14H21FN2.ClH/c1-17(11-13-5-3-7-16-9-13)10-12-4-2-6-14(15)8-12;/h2,4,6,8,13,16H,3,5,7,9-11H2,1H3;1H |
| InChIKey | CDHNKFTUUYVABX-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.79 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |