C28H34N8O5 — CID 11993010
tert-butyl (2S)-2-[[2-(diethylamino)-5-nitropyrimidin-4-yl]amino]-3-[4-(1-methyl-2-oxoimidazo[4,5-b]pyridin-3-yl)phenyl]propanoate (PubChem CID 11993010) has the molecular formula C28H34N8O5 and a molecular weight of 562.63 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[2-(diethylamino)-5-nitropyrimidin-4-yl]amino]-3-[4-(1-methyl-2-oxoimidazo[4,5-b]pyridin-3-yl)phenyl]propanoate.
| Compound Name | tert-butyl (2S)-2-[[2-(diethylamino)-5-nitropyrimidin-4-yl]amino]-3-[4-(1-methyl-2-oxoimidazo[4,5-b]pyridin-3-yl)phenyl]propanoate |
|---|---|
| PubChem CID | 11993010 |
| Molecular Formula | C28H34N8O5 |
| Molecular Weight | 562.63 g/mol |
| Exact Mass | 562.27 |
| IUPAC Name | tert-butyl (2S)-2-[[2-(diethylamino)-5-nitropyrimidin-4-yl]amino]-3-[4-(1-methyl-2-oxoimidazo[4,5-b]pyridin-3-yl)phenyl]propanoate |
| SMILES | CCN(CC)c1ncc([N+](=O)[O-])c(N[C@@H](Cc2ccc(-n3c(=O)n(C)c4cccnc43)cc2)C(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C28H34N8O5/c1-7-34(8-2)26-30-17-22(36(39)40)23(32-26)31-20(25(37)41-28(3,4)5)16-18-11-13-19(14-12-18)35-24-21(10-9-15-29-24)33(6)27(35)38/h9-15,17,20H,7-8,16H2,1-6H3,(H,30,31,32)/t20-/m0/s1 |
| InChIKey | WMOSWKWJQZKQDC-FQEVSTJZSA-N |
| XLogP | 3.63 |
| TPSA | 150.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.63 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|