C26H39N3O4 — CID 11993100
butyl 1'-(1-ethoxycarbonylpiperidin-4-yl)spiro[1,3-dihydroisoquinoline-4,4'-piperidine]-2-carboxylate (PubChem CID 11993100) has the molecular formula C26H39N3O4 and a molecular weight of 457.62 g/mol. Its IUPAC name is butyl 1'-(1-ethoxycarbonylpiperidin-4-yl)spiro[1,3-dihydroisoquinoline-4,4'-piperidine]-2-carboxylate.
| Compound Name | butyl 1'-(1-ethoxycarbonylpiperidin-4-yl)spiro[1,3-dihydroisoquinoline-4,4'-piperidine]-2-carboxylate |
|---|---|
| PubChem CID | 11993100 |
| Molecular Formula | C26H39N3O4 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.29 |
| IUPAC Name | butyl 1'-(1-ethoxycarbonylpiperidin-4-yl)spiro[1,3-dihydroisoquinoline-4,4'-piperidine]-2-carboxylate |
| SMILES | CCCCOC(=O)N1Cc2ccccc2C2(CCN(C3CCN(C(=O)OCC)CC3)CC2)C1 |
| InChI | InChI=1S/C26H39N3O4/c1-3-5-18-33-25(31)29-19-21-8-6-7-9-23(21)26(20-29)12-16-27(17-13-26)22-10-14-28(15-11-22)24(30)32-4-2/h6-9,22H,3-5,10-20H2,1-2H3 |
| InChIKey | OERYHDGSQPDRFC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|