C16H27ClN2 — CID 119931376
N-methyl-2-phenyl-N-(piperidin-3-ylmethyl)propan-1-amine;hydrochloride (PubChem CID 119931376) has the molecular formula C16H27ClN2 and a molecular weight of 282.86 g/mol. Its IUPAC name is N-methyl-2-phenyl-N-(piperidin-3-ylmethyl)propan-1-amine;hydrochloride.
| Compound Name | N-methyl-2-phenyl-N-(piperidin-3-ylmethyl)propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 119931376 |
| Molecular Formula | C16H27ClN2 |
| Molecular Weight | 282.86 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | N-methyl-2-phenyl-N-(piperidin-3-ylmethyl)propan-1-amine;hydrochloride |
| SMILES | CC(CN(C)CC1CCCNC1)c1ccccc1.Cl |
| InChI | InChI=1S/C16H26N2.ClH/c1-14(16-8-4-3-5-9-16)12-18(2)13-15-7-6-10-17-11-15;/h3-5,8-9,14-15,17H,6-7,10-13H2,1-2H3;1H |
| InChIKey | PHMKMPBQSRWAPX-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.86 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |