C17H33ClN2O — CID 119932022
3-ethoxy-N-methyl-N-(piperidin-4-ylmethyl)spiro[3.4]octan-1-amine;hydrochloride (PubChem CID 119932022) has the molecular formula C17H33ClN2O and a molecular weight of 316.92 g/mol. Its IUPAC name is 3-ethoxy-N-methyl-N-(piperidin-4-ylmethyl)spiro[3.4]octan-1-amine;hydrochloride.
| Compound Name | 3-ethoxy-N-methyl-N-(piperidin-4-ylmethyl)spiro[3.4]octan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 119932022 |
| Molecular Formula | C17H33ClN2O |
| Molecular Weight | 316.92 g/mol |
| Exact Mass | 316.23 |
| IUPAC Name | 3-ethoxy-N-methyl-N-(piperidin-4-ylmethyl)spiro[3.4]octan-1-amine;hydrochloride |
| SMILES | CCOC1CC(N(C)CC2CCNCC2)C12CCCC2.Cl |
| InChI | InChI=1S/C17H32N2O.ClH/c1-3-20-16-12-15(17(16)8-4-5-9-17)19(2)13-14-6-10-18-11-7-14;/h14-16,18H,3-13H2,1-2H3;1H |
| InChIKey | DFORERSQXZHDPC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.92 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |