C12H16ClFN2O2 — CID 119934296
[(3S)-3-aminopyrrolidin-1-yl]-(2-fluoro-6-methoxyphenyl)methanone;hydrochloride (PubChem CID 119934296) has the molecular formula C12H16ClFN2O2 and a molecular weight of 274.72 g/mol. Its IUPAC name is [(3S)-3-aminopyrrolidin-1-yl]-(2-fluoro-6-methoxyphenyl)methanone;hydrochloride.
| Compound Name | [(3S)-3-aminopyrrolidin-1-yl]-(2-fluoro-6-methoxyphenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119934296 |
| Molecular Formula | C12H16ClFN2O2 |
| Molecular Weight | 274.72 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | [(3S)-3-aminopyrrolidin-1-yl]-(2-fluoro-6-methoxyphenyl)methanone;hydrochloride |
| SMILES | COc1cccc(F)c1C(=O)N1CC[C@H](N)C1.Cl |
| InChI | InChI=1S/C12H15FN2O2.ClH/c1-17-10-4-2-3-9(13)11(10)12(16)15-6-5-8(14)7-15;/h2-4,8H,5-7,14H2,1H3;1H/t8-;/m0./s1 |
| InChIKey | UZFBXMMHQFNMER-QRPNPIFTSA-N |
| XLogP | 1.43 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.72 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |