2-[4-[2-(3,5-dimethylphenoxy)acetyl]piperazin-1-yl]acetic acid

C16H22N2O4 — CID 119934690

IUPAC2-[4-[2-(3,5-dimethylphenoxy)acetyl]piperazin-1-yl]acetic acid
SMILESCc1cc(C)cc(OCC(=O)N2CCN(CC(=O)O)CC2)c1
InChIInChI=1S/C16H22N2O4/c1-12-7-13(2)9-14(8-12)22-11-15(19)18-5-3-17(4-6-18)10-16(20)21/h7-9H,3-6,10-11H2,1-2H3,(H,20,21)
InChIKeyWEUZUUWQBUGSQX-UHFFFAOYSA-N
MW306.36 g/mol
LogP0.91
Rot. Bonds5

About 2-[4-[2-(3,5-dimethylphenoxy)acetyl]piperazin-1-yl]acetic acid

2-[4-[2-(3,5-dimethylphenoxy)acetyl]piperazin-1-yl]acetic acid (PubChem CID 119934690) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is 2-[4-[2-(3,5-dimethylphenoxy)acetyl]piperazin-1-yl]acetic acid.

Molecular Properties

Compound Name2-[4-[2-(3,5-dimethylphenoxy)acetyl]piperazin-1-yl]acetic acid
PubChem CID119934690
Molecular FormulaC16H22N2O4
Molecular Weight306.36 g/mol
Exact Mass306.16
IUPAC Name2-[4-[2-(3,5-dimethylphenoxy)acetyl]piperazin-1-yl]acetic acid
SMILESCc1cc(C)cc(OCC(=O)N2CCN(CC(=O)O)CC2)c1
InChIInChI=1S/C16H22N2O4/c1-12-7-13(2)9-14(8-12)22-11-15(19)18-5-3-17(4-6-18)10-16(20)21/h7-9H,3-6,10-11H2,1-2H3,(H,20,21)
InChIKeyWEUZUUWQBUGSQX-UHFFFAOYSA-N
XLogP0.91
TPSA70.08 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500306.36
LogP ≤ 50.91
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[4-[2-(3,5-dimethylphenoxy)acetyl]piperazin-1-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-[2-(3,5-dimethylphenoxy)acetyl]piperazin-1-yl]acetic acid?
The IUPAC name of 2-[4-[2-(3,5-dimethylphenoxy)acetyl]piperazin-1-yl]acetic acid (CID 119934690) is 2-[4-[2-(3,5-dimethylphenoxy)acetyl]piperazin-1-yl]acetic acid.
What is the SMILES notation for 2-[4-[2-(3,5-dimethylphenoxy)acetyl]piperazin-1-yl]acetic acid?
The canonical SMILES for 2-[4-[2-(3,5-dimethylphenoxy)acetyl]piperazin-1-yl]acetic acid is Cc1cc(C)cc(OCC(=O)N2CCN(CC(=O)O)CC2)c1.
What is the InChIKey of 2-[4-[2-(3,5-dimethylphenoxy)acetyl]piperazin-1-yl]acetic acid?
The InChIKey is WEUZUUWQBUGSQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2O4/c1-12-7-13(2)9-14(8-12)22-11-15(19)18-5-3-17(4-6-18)10-16(20)21/h7-9H,3-6,10-11H2,1-2H3,(H,20,21).
What are the key properties of 2-[4-[2-(3,5-dimethylphenoxy)acetyl]piperazin-1-yl]acetic acid?
2-[4-[2-(3,5-dimethylphenoxy)acetyl]piperazin-1-yl]acetic acid has a molecular weight of 306.36 g/mol, XLogP of 0.91, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[2-(3,5-dimethylphenoxy)acetyl]piperazin-1-yl]acetic acid is sourced from PubChem (CID 119934690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).