About disodium;2-sulfonatooxyethyl sulfate
disodium;2-sulfonatooxyethyl sulfate (PubChem CID 11993668) has the molecular formula C2H4Na2O8S2
and a molecular weight of 266.16 g/mol. Its IUPAC name is disodium;2-sulfonatooxyethyl sulfate.
Molecular Properties
| Compound Name | disodium;2-sulfonatooxyethyl sulfate |
| PubChem CID | 11993668 |
| Molecular Formula | C2H4Na2O8S2 |
| Molecular Weight | 266.16 g/mol |
| Exact Mass | 265.91 |
| IUPAC Name | disodium;2-sulfonatooxyethyl sulfate |
| SMILES | O=S(=O)([O-])OCCOS(=O)(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C2H6O8S2.2Na/c3-11(4,5)9-1-2-10-12(6,7)8;;/h1-2H2,(H,3,4,5)(H,6,7,8);;/q;2*+1/p-2 |
| InChIKey | CJNVCYNYDISOGM-UHFFFAOYSA-L |
| XLogP | -8.05 |
| TPSA | 132.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.16 |
| LogP ≤ 5 | -8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze disodium;2-sulfonatooxyethyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;2-sulfonatooxyethyl sulfate?
The IUPAC name of disodium;2-sulfonatooxyethyl sulfate (CID 11993668) is disodium;2-sulfonatooxyethyl sulfate.
What is the SMILES notation for disodium;2-sulfonatooxyethyl sulfate?
The canonical SMILES for disodium;2-sulfonatooxyethyl sulfate is O=S(=O)([O-])OCCOS(=O)(=O)[O-].[Na+].[Na+].
What is the InChIKey of disodium;2-sulfonatooxyethyl sulfate?
The InChIKey is CJNVCYNYDISOGM-UHFFFAOYSA-L. The full InChI is InChI=1S/C2H6O8S2.2Na/c3-11(4,5)9-1-2-10-12(6,7)8;;/h1-2H2,(H,3,4,5)(H,6,7,8);;/q;2*+1/p-2.
What are the key properties of disodium;2-sulfonatooxyethyl sulfate?
disodium;2-sulfonatooxyethyl sulfate has a molecular weight of 266.16 g/mol, XLogP of -8.05, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;2-sulfonatooxyethyl sulfate is sourced from PubChem (CID 11993668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).