C28H30F3N5O — CID 11993681
2-[4-(benzimidazol-1-yl)phenyl]-N-[4-[3-(dimethylamino)propyl-methylamino]-3-(trifluoromethyl)phenyl]acetamide (PubChem CID 11993681) has the molecular formula C28H30F3N5O and a molecular weight of 509.58 g/mol. Its IUPAC name is 2-[4-(benzimidazol-1-yl)phenyl]-N-[4-[3-(dimethylamino)propyl-methylamino]-3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[4-(benzimidazol-1-yl)phenyl]-N-[4-[3-(dimethylamino)propyl-methylamino]-3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 11993681 |
| Molecular Formula | C28H30F3N5O |
| Molecular Weight | 509.58 g/mol |
| Exact Mass | 509.24 |
| IUPAC Name | 2-[4-(benzimidazol-1-yl)phenyl]-N-[4-[3-(dimethylamino)propyl-methylamino]-3-(trifluoromethyl)phenyl]acetamide |
| SMILES | CN(C)CCCN(C)c1ccc(NC(=O)Cc2ccc(-n3cnc4ccccc43)cc2)cc1C(F)(F)F |
| InChI | InChI=1S/C28H30F3N5O/c1-34(2)15-6-16-35(3)25-14-11-21(18-23(25)28(29,30)31)33-27(37)17-20-9-12-22(13-10-20)36-19-32-24-7-4-5-8-26(24)36/h4-5,7-14,18-19H,6,15-17H2,1-3H3,(H,33,37) |
| InChIKey | NFLQTUOTKNYVBZ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.58 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|