C23H25N3O2 — CID 11993691
N-hydroxy-7,7-bis(1H-indol-3-yl)heptanamide (PubChem CID 11993691) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is N-hydroxy-7,7-bis(1H-indol-3-yl)heptanamide.
| Compound Name | N-hydroxy-7,7-bis(1H-indol-3-yl)heptanamide |
|---|---|
| PubChem CID | 11993691 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | N-hydroxy-7,7-bis(1H-indol-3-yl)heptanamide |
| SMILES | O=C(CCCCCC(c1c[nH]c2ccccc12)c1c[nH]c2ccccc12)NO |
| InChI | InChI=1S/C23H25N3O2/c27-23(26-28)13-3-1-2-8-16(19-14-24-21-11-6-4-9-17(19)21)20-15-25-22-12-7-5-10-18(20)22/h4-7,9-12,14-16,24-25,28H,1-3,8,13H2,(H,26,27) |
| InChIKey | ZWBFOQJCRGCPED-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|