C23H23F2N3O2 — CID 11993692
7,7-bis(4-fluoro-1H-indol-3-yl)-N-hydroxyheptanamide (PubChem CID 11993692) has the molecular formula C23H23F2N3O2 and a molecular weight of 411.45 g/mol. Its IUPAC name is 7,7-bis(4-fluoro-1H-indol-3-yl)-N-hydroxyheptanamide.
| Compound Name | 7,7-bis(4-fluoro-1H-indol-3-yl)-N-hydroxyheptanamide |
|---|---|
| PubChem CID | 11993692 |
| Molecular Formula | C23H23F2N3O2 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 7,7-bis(4-fluoro-1H-indol-3-yl)-N-hydroxyheptanamide |
| SMILES | O=C(CCCCCC(c1c[nH]c2cccc(F)c12)c1c[nH]c2cccc(F)c12)NO |
| InChI | InChI=1S/C23H23F2N3O2/c24-17-7-4-9-19-22(17)15(12-26-19)14(6-2-1-3-11-21(29)28-30)16-13-27-20-10-5-8-18(25)23(16)20/h4-5,7-10,12-14,26-27,30H,1-3,6,11H2,(H,28,29) |
| InChIKey | ZALBCDKLQFUZNN-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|