C13H24ClN3O2S — CID 119936929
6-methyl-1-(2-thiomorpholin-3-ylacetyl)piperidine-3-carboxamide;hydrochloride (PubChem CID 119936929) has the molecular formula C13H24ClN3O2S and a molecular weight of 321.87 g/mol. Its IUPAC name is 6-methyl-1-(2-thiomorpholin-3-ylacetyl)piperidine-3-carboxamide;hydrochloride.
| Compound Name | 6-methyl-1-(2-thiomorpholin-3-ylacetyl)piperidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119936929 |
| Molecular Formula | C13H24ClN3O2S |
| Molecular Weight | 321.87 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 6-methyl-1-(2-thiomorpholin-3-ylacetyl)piperidine-3-carboxamide;hydrochloride |
| SMILES | CC1CCC(C(N)=O)CN1C(=O)CC1CSCCN1.Cl |
| InChI | InChI=1S/C13H23N3O2S.ClH/c1-9-2-3-10(13(14)18)7-16(9)12(17)6-11-8-19-5-4-15-11;/h9-11,15H,2-8H2,1H3,(H2,14,18);1H |
| InChIKey | YGVSOIGLESZBEZ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.87 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |