C17H24ClN3O2S — CID 119939260
N-(2-oxo-1-phenylpiperidin-3-yl)-2-thiomorpholin-3-ylacetamide;hydrochloride (PubChem CID 119939260) has the molecular formula C17H24ClN3O2S and a molecular weight of 369.92 g/mol. Its IUPAC name is N-(2-oxo-1-phenylpiperidin-3-yl)-2-thiomorpholin-3-ylacetamide;hydrochloride.
| Compound Name | N-(2-oxo-1-phenylpiperidin-3-yl)-2-thiomorpholin-3-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119939260 |
| Molecular Formula | C17H24ClN3O2S |
| Molecular Weight | 369.92 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | N-(2-oxo-1-phenylpiperidin-3-yl)-2-thiomorpholin-3-ylacetamide;hydrochloride |
| SMILES | Cl.O=C(CC1CSCCN1)NC1CCCN(c2ccccc2)C1=O |
| InChI | InChI=1S/C17H23N3O2S.ClH/c21-16(11-13-12-23-10-8-18-13)19-15-7-4-9-20(17(15)22)14-5-2-1-3-6-14;/h1-3,5-6,13,15,18H,4,7-12H2,(H,19,21);1H |
| InChIKey | BBJAGIHUVNRYJZ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.92 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |