C17H30O6Si — CID 11993936
dimethyl (2E,6Z)-2-[tert-butyl(dimethyl)silyl]oxy-7-methoxyocta-2,6-dienedioate (PubChem CID 11993936) has the molecular formula C17H30O6Si and a molecular weight of 358.51 g/mol. Its IUPAC name is dimethyl (2E,6Z)-2-[tert-butyl(dimethyl)silyl]oxy-7-methoxyocta-2,6-dienedioate.
| Compound Name | dimethyl (2E,6Z)-2-[tert-butyl(dimethyl)silyl]oxy-7-methoxyocta-2,6-dienedioate |
|---|---|
| PubChem CID | 11993936 |
| Molecular Formula | C17H30O6Si |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | dimethyl (2E,6Z)-2-[tert-butyl(dimethyl)silyl]oxy-7-methoxyocta-2,6-dienedioate |
| SMILES | COC(=O)/C(=C/CC/C=C(/O[Si](C)(C)C(C)(C)C)C(=O)OC)OC |
| InChI | InChI=1S/C17H30O6Si/c1-17(2,3)24(7,8)23-14(16(19)22-6)12-10-9-11-13(20-4)15(18)21-5/h11-12H,9-10H2,1-8H3/b13-11-,14-12+ |
| InChIKey | SQNAHKHJUUHVML-HEEUSZRZSA-N |
| XLogP | 3.55 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|