C17H30N2O2S — CID 119939729
N-(3-ethoxyspiro[3.4]octan-1-yl)-N-methyl-2-thiomorpholin-3-ylacetamide (PubChem CID 119939729) has the molecular formula C17H30N2O2S and a molecular weight of 326.51 g/mol. Its IUPAC name is N-(3-ethoxyspiro[3.4]octan-1-yl)-N-methyl-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-(3-ethoxyspiro[3.4]octan-1-yl)-N-methyl-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 119939729 |
| Molecular Formula | C17H30N2O2S |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | N-(3-ethoxyspiro[3.4]octan-1-yl)-N-methyl-2-thiomorpholin-3-ylacetamide |
| SMILES | CCOC1CC(N(C)C(=O)CC2CSCCN2)C12CCCC2 |
| InChI | InChI=1S/C17H30N2O2S/c1-3-21-15-11-14(17(15)6-4-5-7-17)19(2)16(20)10-13-12-22-9-8-18-13/h13-15,18H,3-12H2,1-2H3 |
| InChIKey | YETNHIPJPSQEOJ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |