About 1,2-diiodobenzene
1,2-diiodobenzene (PubChem CID 11994) has the molecular formula C6H4I2
and a molecular weight of 329.91 g/mol. Its IUPAC name is 1,2-diiodobenzene.
Molecular Properties
| Compound Name | 1,2-diiodobenzene |
| PubChem CID | 11994 |
| Molecular Formula | C6H4I2 |
| Molecular Weight | 329.91 g/mol |
| Exact Mass | 329.84 |
| IUPAC Name | 1,2-diiodobenzene |
| SMILES | Ic1ccccc1I |
| InChI | InChI=1S/C6H4I2/c7-5-3-1-2-4-6(5)8/h1-4H |
| InChIKey | BBOLNFYSRZVALD-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.91 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1,2-diiodobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diiodobenzene?
The IUPAC name of 1,2-diiodobenzene (CID 11994) is 1,2-diiodobenzene.
What is the SMILES notation for 1,2-diiodobenzene?
The canonical SMILES for 1,2-diiodobenzene is Ic1ccccc1I.
What is the InChIKey of 1,2-diiodobenzene?
The InChIKey is BBOLNFYSRZVALD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4I2/c7-5-3-1-2-4-6(5)8/h1-4H.
What are the key properties of 1,2-diiodobenzene?
1,2-diiodobenzene has a molecular weight of 329.91 g/mol, XLogP of 2.90, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diiodobenzene is sourced from PubChem (CID 11994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).