C19H29ClN2O2S — CID 119940328
1-[3-(3-phenylpropoxy)pyrrolidin-1-yl]-2-thiomorpholin-3-ylethanone;hydrochloride (PubChem CID 119940328) has the molecular formula C19H29ClN2O2S and a molecular weight of 384.97 g/mol. Its IUPAC name is 1-[3-(3-phenylpropoxy)pyrrolidin-1-yl]-2-thiomorpholin-3-ylethanone;hydrochloride.
| Compound Name | 1-[3-(3-phenylpropoxy)pyrrolidin-1-yl]-2-thiomorpholin-3-ylethanone;hydrochloride |
|---|---|
| PubChem CID | 119940328 |
| Molecular Formula | C19H29ClN2O2S |
| Molecular Weight | 384.97 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 1-[3-(3-phenylpropoxy)pyrrolidin-1-yl]-2-thiomorpholin-3-ylethanone;hydrochloride |
| SMILES | Cl.O=C(CC1CSCCN1)N1CCC(OCCCc2ccccc2)C1 |
| InChI | InChI=1S/C19H28N2O2S.ClH/c22-19(13-17-15-24-12-9-20-17)21-10-8-18(14-21)23-11-4-7-16-5-2-1-3-6-16;/h1-3,5-6,17-18,20H,4,7-15H2;1H |
| InChIKey | IUWALDPJWUGALF-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.97 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|