C17H32O3 — CID 11994130
2-[(3R,4R,6S)-4-ethyl-6-[(E,2R)-2-ethylhex-3-enyl]-6-methyldioxan-3-yl]ethanol (PubChem CID 11994130) has the molecular formula C17H32O3 and a molecular weight of 284.44 g/mol. Its IUPAC name is 2-[(3R,4R,6S)-4-ethyl-6-[(E,2R)-2-ethylhex-3-enyl]-6-methyldioxan-3-yl]ethanol.
| Compound Name | 2-[(3R,4R,6S)-4-ethyl-6-[(E,2R)-2-ethylhex-3-enyl]-6-methyldioxan-3-yl]ethanol |
|---|---|
| PubChem CID | 11994130 |
| Molecular Formula | C17H32O3 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.24 |
| IUPAC Name | 2-[(3R,4R,6S)-4-ethyl-6-[(E,2R)-2-ethylhex-3-enyl]-6-methyldioxan-3-yl]ethanol |
| SMILES | CC/C=C/[C@H](CC)C[C@@]1(C)C[C@@H](CC)[C@@H](CCO)OO1 |
| InChI | InChI=1S/C17H32O3/c1-5-8-9-14(6-2)12-17(4)13-15(7-3)16(10-11-18)19-20-17/h8-9,14-16,18H,5-7,10-13H2,1-4H3/b9-8+/t14-,15+,16+,17-/m0/s1 |
| InChIKey | WUWNQYAMHUWBKI-JKVRWEBCSA-N |
| XLogP | 4.26 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|