C12H18F2N4OS — CID 119941317
N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-methyl-2-thiomorpholin-3-ylacetamide (PubChem CID 119941317) has the molecular formula C12H18F2N4OS and a molecular weight of 304.37 g/mol. Its IUPAC name is N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-methyl-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-methyl-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 119941317 |
| Molecular Formula | C12H18F2N4OS |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-methyl-2-thiomorpholin-3-ylacetamide |
| SMILES | CN(Cc1nccn1C(F)F)C(=O)CC1CSCCN1 |
| InChI | InChI=1S/C12H18F2N4OS/c1-17(7-10-16-2-4-18(10)12(13)14)11(19)6-9-8-20-5-3-15-9/h2,4,9,12,15H,3,5-8H2,1H3 |
| InChIKey | GRGHYSOKSCAEAT-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |