C18H29Cl2N3O2S — CID 119941502
N-[4-(2-morpholin-4-ylethyl)phenyl]-2-thiomorpholin-3-ylacetamide;dihydrochloride (PubChem CID 119941502) has the molecular formula C18H29Cl2N3O2S and a molecular weight of 422.42 g/mol. Its IUPAC name is N-[4-(2-morpholin-4-ylethyl)phenyl]-2-thiomorpholin-3-ylacetamide;dihydrochloride.
| Compound Name | N-[4-(2-morpholin-4-ylethyl)phenyl]-2-thiomorpholin-3-ylacetamide;dihydrochloride |
|---|---|
| PubChem CID | 119941502 |
| Molecular Formula | C18H29Cl2N3O2S |
| Molecular Weight | 422.42 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | N-[4-(2-morpholin-4-ylethyl)phenyl]-2-thiomorpholin-3-ylacetamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(CC1CSCCN1)Nc1ccc(CCN2CCOCC2)cc1 |
| InChI | InChI=1S/C18H27N3O2S.2ClH/c22-18(13-17-14-24-12-6-19-17)20-16-3-1-15(2-4-16)5-7-21-8-10-23-11-9-21;;/h1-4,17,19H,5-14H2,(H,20,22);2*1H |
| InChIKey | FWSLGGGXZOYWRK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |