C26H36O4 — CID 11994177
[(1S,4aR,4bR,6aS,7R,10aR,12aR)-7,8-diformyl-1,4a,6a-trimethyl-3,4,4b,5,6,7,10,10a,12,12a-decahydro-2H-chrysen-1-yl]methyl acetate (PubChem CID 11994177) has the molecular formula C26H36O4 and a molecular weight of 412.57 g/mol. Its IUPAC name is [(1S,4aR,4bR,6aS,7R,10aR,12aR)-7,8-diformyl-1,4a,6a-trimethyl-3,4,4b,5,6,7,10,10a,12,12a-decahydro-2H-chrysen-1-yl]methyl acetate.
| Compound Name | [(1S,4aR,4bR,6aS,7R,10aR,12aR)-7,8-diformyl-1,4a,6a-trimethyl-3,4,4b,5,6,7,10,10a,12,12a-decahydro-2H-chrysen-1-yl]methyl acetate |
|---|---|
| PubChem CID | 11994177 |
| Molecular Formula | C26H36O4 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | [(1S,4aR,4bR,6aS,7R,10aR,12aR)-7,8-diformyl-1,4a,6a-trimethyl-3,4,4b,5,6,7,10,10a,12,12a-decahydro-2H-chrysen-1-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@]1(C)CCC[C@]2(C)[C@H]3CC[C@]4(C)[C@@H](C=O)C(C=O)=CC[C@H]4C3=CC[C@@H]12 |
| InChI | InChI=1S/C26H36O4/c1-17(29)30-16-24(2)11-5-12-26(4)21-10-13-25(3)20(19(21)7-9-23(24)26)8-6-18(14-27)22(25)15-28/h6-7,14-15,20-23H,5,8-13,16H2,1-4H3/t20-,21-,22-,23-,24+,25-,26+/m0/s1 |
| InChIKey | TYAAQNFJICIASZ-XGWBYYDQSA-N |
| XLogP | 5.07 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|