C16H33Cl2N3O2S — CID 119942038
1-[4-(2-ethoxyethyl)-3-ethylpiperazin-1-yl]-2-thiomorpholin-3-ylethanone;dihydrochloride (PubChem CID 119942038) has the molecular formula C16H33Cl2N3O2S and a molecular weight of 402.43 g/mol. Its IUPAC name is 1-[4-(2-ethoxyethyl)-3-ethylpiperazin-1-yl]-2-thiomorpholin-3-ylethanone;dihydrochloride.
| Compound Name | 1-[4-(2-ethoxyethyl)-3-ethylpiperazin-1-yl]-2-thiomorpholin-3-ylethanone;dihydrochloride |
|---|---|
| PubChem CID | 119942038 |
| Molecular Formula | C16H33Cl2N3O2S |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 1-[4-(2-ethoxyethyl)-3-ethylpiperazin-1-yl]-2-thiomorpholin-3-ylethanone;dihydrochloride |
| SMILES | CCOCCN1CCN(C(=O)CC2CSCCN2)CC1CC.Cl.Cl |
| InChI | InChI=1S/C16H31N3O2S.2ClH/c1-3-15-12-19(7-6-18(15)8-9-21-4-2)16(20)11-14-13-22-10-5-17-14;;/h14-15,17H,3-13H2,1-2H3;2*1H |
| InChIKey | PWDTUGZDMQUGMV-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|