C19H34O4 — CID 11994268
2-[(3R,4R,6S)-4-ethyl-6-[(E,2R)-2-ethylhex-3-enyl]-6-methyldioxan-3-yl]ethyl acetate (PubChem CID 11994268) has the molecular formula C19H34O4 and a molecular weight of 326.48 g/mol. Its IUPAC name is 2-[(3R,4R,6S)-4-ethyl-6-[(E,2R)-2-ethylhex-3-enyl]-6-methyldioxan-3-yl]ethyl acetate.
| Compound Name | 2-[(3R,4R,6S)-4-ethyl-6-[(E,2R)-2-ethylhex-3-enyl]-6-methyldioxan-3-yl]ethyl acetate |
|---|---|
| PubChem CID | 11994268 |
| Molecular Formula | C19H34O4 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | 2-[(3R,4R,6S)-4-ethyl-6-[(E,2R)-2-ethylhex-3-enyl]-6-methyldioxan-3-yl]ethyl acetate |
| SMILES | CC/C=C/[C@H](CC)C[C@@]1(C)C[C@@H](CC)[C@@H](CCOC(C)=O)OO1 |
| InChI | InChI=1S/C19H34O4/c1-6-9-10-16(7-2)13-19(5)14-17(8-3)18(22-23-19)11-12-21-15(4)20/h9-10,16-18H,6-8,11-14H2,1-5H3/b10-9+/t16-,17+,18+,19-/m0/s1 |
| InChIKey | QZXVNIRWCADZLA-APOUZTMKSA-N |
| XLogP | 4.83 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|