C13H21ClN2O — CID 119943594
2-amino-N,N-dipropylbenzamide;hydrochloride (PubChem CID 119943594) has the molecular formula C13H21ClN2O and a molecular weight of 256.78 g/mol. Its IUPAC name is 2-amino-N,N-dipropylbenzamide;hydrochloride.
| Compound Name | 2-amino-N,N-dipropylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119943594 |
| Molecular Formula | C13H21ClN2O |
| Molecular Weight | 256.78 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 2-amino-N,N-dipropylbenzamide;hydrochloride |
| SMILES | CCCN(CCC)C(=O)c1ccccc1N.Cl |
| InChI | InChI=1S/C13H20N2O.ClH/c1-3-9-15(10-4-2)13(16)11-7-5-6-8-12(11)14;/h5-8H,3-4,9-10,14H2,1-2H3;1H |
| InChIKey | GUAVRZPTVOOQEA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.78 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|