C14H22ClN3O2 — CID 119944538
N-(1-ethyl-6-oxo-3-pyridinyl)-3-methylpiperidine-3-carboxamide;hydrochloride (PubChem CID 119944538) has the molecular formula C14H22ClN3O2 and a molecular weight of 299.80 g/mol. Its IUPAC name is N-(1-ethyl-6-oxo-3-pyridinyl)-3-methylpiperidine-3-carboxamide;hydrochloride.
| Compound Name | N-(1-ethyl-6-oxo-3-pyridinyl)-3-methylpiperidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119944538 |
| Molecular Formula | C14H22ClN3O2 |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | N-(1-ethyl-6-oxo-3-pyridinyl)-3-methylpiperidine-3-carboxamide;hydrochloride |
| SMILES | CCn1cc(NC(=O)C2(C)CCCNC2)ccc1=O.Cl |
| InChI | InChI=1S/C14H21N3O2.ClH/c1-3-17-9-11(5-6-12(17)18)16-13(19)14(2)7-4-8-15-10-14;/h5-6,9,15H,3-4,7-8,10H2,1-2H3,(H,16,19);1H |
| InChIKey | JWZYIEFERZRWEC-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |