C19H24N2O3 — CID 119945325
2-amino-N-[2-(3,4-dimethoxyphenyl)-2-methylpropyl]benzamide (PubChem CID 119945325) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is 2-amino-N-[2-(3,4-dimethoxyphenyl)-2-methylpropyl]benzamide.
| Compound Name | 2-amino-N-[2-(3,4-dimethoxyphenyl)-2-methylpropyl]benzamide |
|---|---|
| PubChem CID | 119945325 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 2-amino-N-[2-(3,4-dimethoxyphenyl)-2-methylpropyl]benzamide |
| SMILES | COc1ccc(C(C)(C)CNC(=O)c2ccccc2N)cc1OC |
| InChI | InChI=1S/C19H24N2O3/c1-19(2,13-9-10-16(23-3)17(11-13)24-4)12-21-18(22)14-7-5-6-8-15(14)20/h5-11H,12,20H2,1-4H3,(H,21,22) |
| InChIKey | ZORWWYPJHDKUDU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|