C11H23ClN2O3S — CID 119945471
3-methyl-N-(1-methylsulfonylpropan-2-yl)piperidine-3-carboxamide;hydrochloride (PubChem CID 119945471) has the molecular formula C11H23ClN2O3S and a molecular weight of 298.84 g/mol. Its IUPAC name is 3-methyl-N-(1-methylsulfonylpropan-2-yl)piperidine-3-carboxamide;hydrochloride.
| Compound Name | 3-methyl-N-(1-methylsulfonylpropan-2-yl)piperidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119945471 |
| Molecular Formula | C11H23ClN2O3S |
| Molecular Weight | 298.84 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 3-methyl-N-(1-methylsulfonylpropan-2-yl)piperidine-3-carboxamide;hydrochloride |
| SMILES | CC(CS(C)(=O)=O)NC(=O)C1(C)CCCNC1.Cl |
| InChI | InChI=1S/C11H22N2O3S.ClH/c1-9(7-17(3,15)16)13-10(14)11(2)5-4-6-12-8-11;/h9,12H,4-8H2,1-3H3,(H,13,14);1H |
| InChIKey | XLKNLWMNYYDITL-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.84 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |