C29H30N7O5P — CID 11994564
methyl (2R)-2-[[[(1R,4S)-4-(6-aminopurin-9-yl)cyclopent-2-en-1-yl]methoxy-phenoxyphosphoryl]amino]-3-(1H-indol-3-yl)propanoate (PubChem CID 11994564) has the molecular formula C29H30N7O5P and a molecular weight of 587.58 g/mol. Its IUPAC name is methyl (2R)-2-[[[(1R,4S)-4-(6-aminopurin-9-yl)cyclopent-2-en-1-yl]methoxy-phenoxyphosphoryl]amino]-3-(1H-indol-3-yl)propanoate.
| Compound Name | methyl (2R)-2-[[[(1R,4S)-4-(6-aminopurin-9-yl)cyclopent-2-en-1-yl]methoxy-phenoxyphosphoryl]amino]-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 11994564 |
| Molecular Formula | C29H30N7O5P |
| Molecular Weight | 587.58 g/mol |
| Exact Mass | 587.20 |
| IUPAC Name | methyl (2R)-2-[[[(1R,4S)-4-(6-aminopurin-9-yl)cyclopent-2-en-1-yl]methoxy-phenoxyphosphoryl]amino]-3-(1H-indol-3-yl)propanoate |
| SMILES | COC(=O)[C@@H](Cc1c[nH]c2ccccc12)NP(=O)(OC[C@H]1C=C[C@@H](n2cnc3c(N)ncnc32)C1)Oc1ccccc1 |
| InChI | InChI=1S/C29H30N7O5P/c1-39-29(37)25(14-20-15-31-24-10-6-5-9-23(20)24)35-42(38,41-22-7-3-2-4-8-22)40-16-19-11-12-21(13-19)36-18-34-26-27(30)32-17-33-28(26)36/h2-12,15,17-19,21,25,31H,13-14,16H2,1H3,(H,35,38)(H2,30,32,33)/t19-,21+,25+,42?/m0/s1 |
| InChIKey | OTISJZZZQHLPLU-FXPMLRSHSA-N |
| XLogP | 4.58 |
| TPSA | 159.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.58 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|