C18H23N5O3 — CID 119945711
2-amino-N-[1-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl]pyrazol-4-yl]benzamide (PubChem CID 119945711) has the molecular formula C18H23N5O3 and a molecular weight of 357.41 g/mol. Its IUPAC name is 2-amino-N-[1-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl]pyrazol-4-yl]benzamide.
| Compound Name | 2-amino-N-[1-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl]pyrazol-4-yl]benzamide |
|---|---|
| PubChem CID | 119945711 |
| Molecular Formula | C18H23N5O3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 2-amino-N-[1-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl]pyrazol-4-yl]benzamide |
| SMILES | CC1CN(C(=O)Cn2cc(NC(=O)c3ccccc3N)cn2)CC(C)O1 |
| InChI | InChI=1S/C18H23N5O3/c1-12-8-22(9-13(2)26-12)17(24)11-23-10-14(7-20-23)21-18(25)15-5-3-4-6-16(15)19/h3-7,10,12-13H,8-9,11,19H2,1-2H3,(H,21,25) |
| InChIKey | RXDPVMDHCMUGKX-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|