C20H27Cl2N3O3 — CID 119946117
(2-aminophenyl)-[4-[(2,5-dimethoxyphenyl)methyl]piperazin-1-yl]methanone;dihydrochloride (PubChem CID 119946117) has the molecular formula C20H27Cl2N3O3 and a molecular weight of 428.36 g/mol. Its IUPAC name is (2-aminophenyl)-[4-[(2,5-dimethoxyphenyl)methyl]piperazin-1-yl]methanone;dihydrochloride.
| Compound Name | (2-aminophenyl)-[4-[(2,5-dimethoxyphenyl)methyl]piperazin-1-yl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 119946117 |
| Molecular Formula | C20H27Cl2N3O3 |
| Molecular Weight | 428.36 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | (2-aminophenyl)-[4-[(2,5-dimethoxyphenyl)methyl]piperazin-1-yl]methanone;dihydrochloride |
| SMILES | COc1ccc(OC)c(CN2CCN(C(=O)c3ccccc3N)CC2)c1.Cl.Cl |
| InChI | InChI=1S/C20H25N3O3.2ClH/c1-25-16-7-8-19(26-2)15(13-16)14-22-9-11-23(12-10-22)20(24)17-5-3-4-6-18(17)21;;/h3-8,13H,9-12,14,21H2,1-2H3;2*1H |
| InChIKey | FPWYLXRMEXUGFY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 68.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|