C16H24ClN3OS — CID 119946201
[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-(3-methylpiperidin-3-yl)methanone (PubChem CID 119946201) has the molecular formula C16H24ClN3OS and a molecular weight of 341.91 g/mol. Its IUPAC name is [4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-(3-methylpiperidin-3-yl)methanone.
| Compound Name | [4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-(3-methylpiperidin-3-yl)methanone |
|---|---|
| PubChem CID | 119946201 |
| Molecular Formula | C16H24ClN3OS |
| Molecular Weight | 341.91 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | [4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-(3-methylpiperidin-3-yl)methanone |
| SMILES | CC1(C(=O)N2CCN(Cc3ccc(Cl)s3)CC2)CCCNC1 |
| InChI | InChI=1S/C16H24ClN3OS/c1-16(5-2-6-18-12-16)15(21)20-9-7-19(8-10-20)11-13-3-4-14(17)22-13/h3-4,18H,2,5-12H2,1H3 |
| InChIKey | LNZUGXVLWQXZBQ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.91 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |