C24H26ClNO4 — CID 11994668
N-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-2-(2-methoxy-5-phenylphenoxy)ethanamine;hydrochloride (PubChem CID 11994668) has the molecular formula C24H26ClNO4 and a molecular weight of 427.93 g/mol. Its IUPAC name is N-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-2-(2-methoxy-5-phenylphenoxy)ethanamine;hydrochloride.
| Compound Name | N-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-2-(2-methoxy-5-phenylphenoxy)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 11994668 |
| Molecular Formula | C24H26ClNO4 |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | N-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-2-(2-methoxy-5-phenylphenoxy)ethanamine;hydrochloride |
| SMILES | COc1ccc(-c2ccccc2)cc1OCCNC[C@@H]1COc2ccccc2O1.Cl |
| InChI | InChI=1S/C24H25NO4.ClH/c1-26-21-12-11-19(18-7-3-2-4-8-18)15-24(21)27-14-13-25-16-20-17-28-22-9-5-6-10-23(22)29-20;/h2-12,15,20,25H,13-14,16-17H2,1H3;1H/t20-;/m1./s1 |
| InChIKey | JHHAAVCPJVMVLF-VEIFNGETSA-N |
| XLogP | 4.59 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|