C23H23NO2 — CID 11994756
12-cyclohexyl-5,6-dihydroindolo[2,1-a]isoquinoline-9-carboxylic acid (PubChem CID 11994756) has the molecular formula C23H23NO2 and a molecular weight of 345.44 g/mol. Its IUPAC name is 12-cyclohexyl-5,6-dihydroindolo[2,1-a]isoquinoline-9-carboxylic acid.
| Compound Name | 12-cyclohexyl-5,6-dihydroindolo[2,1-a]isoquinoline-9-carboxylic acid |
|---|---|
| PubChem CID | 11994756 |
| Molecular Formula | C23H23NO2 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 12-cyclohexyl-5,6-dihydroindolo[2,1-a]isoquinoline-9-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(C3CCCCC3)c3n(c2c1)CCc1ccccc1-3 |
| InChI | InChI=1S/C23H23NO2/c25-23(26)17-10-11-19-20(14-17)24-13-12-15-6-4-5-9-18(15)22(24)21(19)16-7-2-1-3-8-16/h4-6,9-11,14,16H,1-3,7-8,12-13H2,(H,25,26) |
| InChIKey | IQUUYNDMIQDMKP-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |