About [1-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]cyclopentyl]methanamine;hydrochloride
[1-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]cyclopentyl]methanamine;hydrochloride (PubChem CID 119947677) has the molecular formula C16H22ClN3O
and a molecular weight of 307.82 g/mol. Its IUPAC name is [1-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]cyclopentyl]methanamine;hydrochloride.
Molecular Properties
| Compound Name | [1-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]cyclopentyl]methanamine;hydrochloride |
| PubChem CID | 119947677 |
| Molecular Formula | C16H22ClN3O |
| Molecular Weight | 307.82 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | [1-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]cyclopentyl]methanamine;hydrochloride |
| SMILES | Cl.NCC1(c2nc(CCc3ccccc3)no2)CCCC1 |
| InChI | InChI=1S/C16H21N3O.ClH/c17-12-16(10-4-5-11-16)15-18-14(19-20-15)9-8-13-6-2-1-3-7-13;/h1-3,6-7H,4-5,8-12,17H2;1H |
| InChIKey | TTZJJOXPXXEBIB-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.82 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]cyclopentyl]methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]cyclopentyl]methanamine;hydrochloride?
The IUPAC name of [1-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]cyclopentyl]methanamine;hydrochloride (CID 119947677) is [1-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]cyclopentyl]methanamine;hydrochloride.
What is the SMILES notation for [1-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]cyclopentyl]methanamine;hydrochloride?
The canonical SMILES for [1-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]cyclopentyl]methanamine;hydrochloride is Cl.NCC1(c2nc(CCc3ccccc3)no2)CCCC1.
What is the InChIKey of [1-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]cyclopentyl]methanamine;hydrochloride?
The InChIKey is TTZJJOXPXXEBIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3O.ClH/c17-12-16(10-4-5-11-16)15-18-14(19-20-15)9-8-13-6-2-1-3-7-13;/h1-3,6-7H,4-5,8-12,17H2;1H.
What are the key properties of [1-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]cyclopentyl]methanamine;hydrochloride?
[1-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]cyclopentyl]methanamine;hydrochloride has a molecular weight of 307.82 g/mol, XLogP of 3.05, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]cyclopentyl]methanamine;hydrochloride is sourced from PubChem (CID 119947677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).