About 3-[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]cyclopentan-1-amine;hydrochloride
3-[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]cyclopentan-1-amine;hydrochloride (PubChem CID 119947825) has the molecular formula C13H15BrClN3O
and a molecular weight of 344.64 g/mol. Its IUPAC name is 3-[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]cyclopentan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 3-[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]cyclopentan-1-amine;hydrochloride |
| PubChem CID | 119947825 |
| Molecular Formula | C13H15BrClN3O |
| Molecular Weight | 344.64 g/mol |
| Exact Mass | 343.01 |
| IUPAC Name | 3-[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]cyclopentan-1-amine;hydrochloride |
| SMILES | Cl.NC1CCC(c2nc(-c3cccc(Br)c3)no2)C1 |
| InChI | InChI=1S/C13H14BrN3O.ClH/c14-10-3-1-2-8(6-10)12-16-13(18-17-12)9-4-5-11(15)7-9;/h1-3,6,9,11H,4-5,7,15H2;1H |
| InChIKey | BRXCYVVVDJXOAL-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.64 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]cyclopentan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]cyclopentan-1-amine;hydrochloride?
The IUPAC name of 3-[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]cyclopentan-1-amine;hydrochloride (CID 119947825) is 3-[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]cyclopentan-1-amine;hydrochloride.
What is the SMILES notation for 3-[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]cyclopentan-1-amine;hydrochloride?
The canonical SMILES for 3-[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]cyclopentan-1-amine;hydrochloride is Cl.NC1CCC(c2nc(-c3cccc(Br)c3)no2)C1.
What is the InChIKey of 3-[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]cyclopentan-1-amine;hydrochloride?
The InChIKey is BRXCYVVVDJXOAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14BrN3O.ClH/c14-10-3-1-2-8(6-10)12-16-13(18-17-12)9-4-5-11(15)7-9;/h1-3,6,9,11H,4-5,7,15H2;1H.
What are the key properties of 3-[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]cyclopentan-1-amine;hydrochloride?
3-[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]cyclopentan-1-amine;hydrochloride has a molecular weight of 344.64 g/mol, XLogP of 3.52, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]cyclopentan-1-amine;hydrochloride is sourced from PubChem (CID 119947825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).