C29H24ClN3O6S — CID 11994783
(Z)-but-2-enedioic acid;6-(4-chlorophenyl)-3-[2-(pyrrolidin-1-ylmethyl)-1-benzofuran-5-yl]thieno[3,2-d]pyrimidin-4-one (PubChem CID 11994783) has the molecular formula C29H24ClN3O6S and a molecular weight of 578.05 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;6-(4-chlorophenyl)-3-[2-(pyrrolidin-1-ylmethyl)-1-benzofuran-5-yl]thieno[3,2-d]pyrimidin-4-one.
| Compound Name | (Z)-but-2-enedioic acid;6-(4-chlorophenyl)-3-[2-(pyrrolidin-1-ylmethyl)-1-benzofuran-5-yl]thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 11994783 |
| Molecular Formula | C29H24ClN3O6S |
| Molecular Weight | 578.05 g/mol |
| Exact Mass | 577.11 |
| IUPAC Name | (Z)-but-2-enedioic acid;6-(4-chlorophenyl)-3-[2-(pyrrolidin-1-ylmethyl)-1-benzofuran-5-yl]thieno[3,2-d]pyrimidin-4-one |
| SMILES | O=C(O)/C=C\C(=O)O.O=c1c2sc(-c3ccc(Cl)cc3)cc2ncn1-c1ccc2oc(CN3CCCC3)cc2c1 |
| InChI | InChI=1S/C25H20ClN3O2S.C4H4O4/c26-18-5-3-16(4-6-18)23-13-21-24(32-23)25(30)29(15-27-21)19-7-8-22-17(11-19)12-20(31-22)14-28-9-1-2-10-28;5-3(6)1-2-4(7)8/h3-8,11-13,15H,1-2,9-10,14H2;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | BWHPQXDOVNKPQJ-BTJKTKAUSA-N |
| XLogP | 5.82 |
| TPSA | 125.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.05 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|