C22H21NO3 — CID 11994883
12-cyclohexyl-6H-indolo[1,2-c][1,3]benzoxazine-9-carboxylic acid (PubChem CID 11994883) has the molecular formula C22H21NO3 and a molecular weight of 347.41 g/mol. Its IUPAC name is 12-cyclohexyl-6H-indolo[1,2-c][1,3]benzoxazine-9-carboxylic acid.
| Compound Name | 12-cyclohexyl-6H-indolo[1,2-c][1,3]benzoxazine-9-carboxylic acid |
|---|---|
| PubChem CID | 11994883 |
| Molecular Formula | C22H21NO3 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 12-cyclohexyl-6H-indolo[1,2-c][1,3]benzoxazine-9-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(C3CCCCC3)c3n(c2c1)COc1ccccc1-3 |
| InChI | InChI=1S/C22H21NO3/c24-22(25)15-10-11-16-18(12-15)23-13-26-19-9-5-4-8-17(19)21(23)20(16)14-6-2-1-3-7-14/h4-5,8-12,14H,1-3,6-7,13H2,(H,24,25) |
| InChIKey | GUIVZRGAWZFXEJ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |