C30H41N3O6 — CID 11994928
(6R,9R,12S)-6-[(4-hydroxyphenyl)methyl]-9-propan-2-yl-12-propyl-2,8-dioxa-5,11,14-triazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione (PubChem CID 11994928) has the molecular formula C30H41N3O6 and a molecular weight of 539.67 g/mol. Its IUPAC name is (6R,9R,12S)-6-[(4-hydroxyphenyl)methyl]-9-propan-2-yl-12-propyl-2,8-dioxa-5,11,14-triazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione.
| Compound Name | (6R,9R,12S)-6-[(4-hydroxyphenyl)methyl]-9-propan-2-yl-12-propyl-2,8-dioxa-5,11,14-triazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione |
|---|---|
| PubChem CID | 11994928 |
| Molecular Formula | C30H41N3O6 |
| Molecular Weight | 539.67 g/mol |
| Exact Mass | 539.30 |
| IUPAC Name | (6R,9R,12S)-6-[(4-hydroxyphenyl)methyl]-9-propan-2-yl-12-propyl-2,8-dioxa-5,11,14-triazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione |
| SMILES | CCC[C@@H]1NC(=O)[C@@H](C(C)C)OC(=O)[C@@H](Cc2ccc(O)cc2)NCCOc2ccccc2CCCNC1=O |
| InChI | InChI=1S/C30H41N3O6/c1-4-8-24-28(35)32-16-7-10-22-9-5-6-11-26(22)38-18-17-31-25(19-21-12-14-23(34)15-13-21)30(37)39-27(20(2)3)29(36)33-24/h5-6,9,11-15,20,24-25,27,31,34H,4,7-8,10,16-19H2,1-3H3,(H,32,35)(H,33,36)/t24-,25+,27+/m0/s1 |
| InChIKey | IPARHFSWWMFDAF-ZWEKWIFMSA-N |
| XLogP | 2.89 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.67 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |