C15H26ClN3O3S — CID 119950038
3-amino-N-[3-[ethylsulfonyl(methyl)amino]propyl]-3-phenylpropanamide;hydrochloride (PubChem CID 119950038) has the molecular formula C15H26ClN3O3S and a molecular weight of 363.91 g/mol. Its IUPAC name is 3-amino-N-[3-[ethylsulfonyl(methyl)amino]propyl]-3-phenylpropanamide;hydrochloride.
| Compound Name | 3-amino-N-[3-[ethylsulfonyl(methyl)amino]propyl]-3-phenylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 119950038 |
| Molecular Formula | C15H26ClN3O3S |
| Molecular Weight | 363.91 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 3-amino-N-[3-[ethylsulfonyl(methyl)amino]propyl]-3-phenylpropanamide;hydrochloride |
| SMILES | CCS(=O)(=O)N(C)CCCNC(=O)CC(N)c1ccccc1.Cl |
| InChI | InChI=1S/C15H25N3O3S.ClH/c1-3-22(20,21)18(2)11-7-10-17-15(19)12-14(16)13-8-5-4-6-9-13;/h4-6,8-9,14H,3,7,10-12,16H2,1-2H3,(H,17,19);1H |
| InChIKey | IHULLDPLPAFPKC-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.91 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|